C27H42N10O5 — CID 18243963
6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 18243963) has the molecular formula C27H42N10O5 and a molecular weight of 586.70 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18243963 |
| Molecular Formula | C27H42N10O5 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccccc1)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C27H42N10O5/c28-11-5-4-10-20(26(41)42)35-24(39)21(13-17-7-2-1-3-8-17)37-25(40)22(14-18-15-32-16-34-18)36-23(38)19(29)9-6-12-33-27(30)31/h1-3,7-8,15-16,19-22H,4-6,9-14,28-29H2,(H,32,34)(H,35,39)(H,36,38)(H,37,40)(H,41,42)(H4,30,31,33) |
| InChIKey | ZNNLOXXROUBNSA-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 269.72 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|