C27H42N10O6 — CID 22651512
2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 22651512) has the molecular formula C27H42N10O6 and a molecular weight of 602.70 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 22651512 |
| Molecular Formula | C27H42N10O6 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C27H42N10O6/c28-10-2-1-5-20(24(40)37-22(26(42)43)13-17-14-32-15-34-17)35-25(41)21(12-16-6-8-18(38)9-7-16)36-23(39)19(29)4-3-11-33-27(30)31/h6-9,14-15,19-22,38H,1-5,10-13,28-29H2,(H,32,34)(H,35,41)(H,36,39)(H,37,40)(H,42,43)(H4,30,31,33) |
| InChIKey | UWSNWYBJULBINN-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 289.95 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|