C30H39N9O6 — CID 18245855
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 18245855) has the molecular formula C30H39N9O6 and a molecular weight of 621.70 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 18245855 |
| Molecular Formula | C30H39N9O6 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C30H39N9O6/c31-22(7-4-12-35-30(32)33)26(41)37-23(13-18-5-2-1-3-6-18)27(42)38-24(15-20-16-34-17-36-20)28(43)39-25(29(44)45)14-19-8-10-21(40)11-9-19/h1-3,5-6,8-11,16-17,22-25,40H,4,7,12-15,31H2,(H,34,36)(H,37,41)(H,38,42)(H,39,43)(H,44,45)(H4,32,33,35) |
| InChIKey | AKHGWSOKTNMGCN-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 263.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|