C25H35N9O7 — CID 175708825
(2S)-2-[[(2R)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 175708825) has the molecular formula C25H35N9O7 and a molecular weight of 573.61 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 175708825 |
| Molecular Formula | C25H35N9O7 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | (2S)-2-[[(2R)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H](N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H35N9O7/c26-16(11-20(35)36)21(37)33-19(10-15-12-29-13-31-15)23(39)34-18(9-14-5-2-1-3-6-14)22(38)32-17(24(40)41)7-4-8-30-25(27)28/h1-3,5-6,12-13,16-19H,4,7-11,26H2,(H,29,31)(H,32,38)(H,33,37)(H,34,39)(H,35,36)(H,40,41)(H4,27,28,30)/t16-,17-,18+,19-/m0/s1 |
| InChIKey | KCQVDMSFYIWIRI-OKYOBFRVSA-N |
| XLogP | -2.41 |
| TPSA | 281.00 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|