C25H37N9O6 — CID 18748553
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18748553) has the molecular formula C25H37N9O6 and a molecular weight of 559.63 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18748553 |
| Molecular Formula | C25H37N9O6 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C25H37N9O6/c1-14(35)20(26)23(38)34-19(11-16-12-29-13-31-16)22(37)33-18(10-15-6-3-2-4-7-15)21(36)32-17(24(39)40)8-5-9-30-25(27)28/h2-4,6-7,12-14,17-20,35H,5,8-11,26H2,1H3,(H,29,31)(H,32,36)(H,33,37)(H,34,38)(H,39,40)(H4,27,28,30) |
| InChIKey | BYPILQIQATUFNK-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 263.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|