C27H38N10O6 — CID 19941017
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 19941017) has the molecular formula C27H38N10O6 and a molecular weight of 598.67 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 19941017 |
| Molecular Formula | C27H38N10O6 |
| Molecular Weight | 598.67 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C27H38N10O6/c1-14(38)22(28)25(41)37-20(9-15-11-33-18-6-3-2-5-17(15)18)23(39)36-21(10-16-12-31-13-34-16)24(40)35-19(26(42)43)7-4-8-32-27(29)30/h2-3,5-6,11-14,19-22,33,38H,4,7-10,28H2,1H3,(H,31,34)(H,35,40)(H,36,39)(H,37,41)(H,42,43)(H4,29,30,32) |
| InChIKey | VSVBUGGWWQRYDE-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 279.72 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.67 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|