C28H38N10O7 — CID 18244037
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid (PubChem CID 18244037) has the molecular formula C28H38N10O7 and a molecular weight of 626.68 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18244037 |
| Molecular Formula | C28H38N10O7 |
| Molecular Weight | 626.68 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]pentanedioic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C28H38N10O7/c29-18(5-3-9-33-28(30)31)24(41)37-22(11-16-13-32-14-35-16)26(43)38-21(10-15-12-34-19-6-2-1-4-17(15)19)25(42)36-20(27(44)45)7-8-23(39)40/h1-2,4,6,12-14,18,20-22,34H,3,5,7-11,29H2,(H,32,35)(H,36,42)(H,37,41)(H,38,43)(H,39,40)(H,44,45)(H4,30,31,33) |
| InChIKey | YVXYMZZTHHUSQT-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 296.79 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.68 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|