C32H40N10O5 — CID 18246023
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18246023) has the molecular formula C32H40N10O5 and a molecular weight of 644.74 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18246023 |
| Molecular Formula | C32H40N10O5 |
| Molecular Weight | 644.74 g/mol |
| Exact Mass | 644.32 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C32H40N10O5/c33-23(10-6-12-37-32(34)35)28(43)40-25(13-19-7-2-1-3-8-19)29(44)41-26(14-20-16-38-24-11-5-4-9-22(20)24)30(45)42-27(31(46)47)15-21-17-36-18-39-21/h1-5,7-9,11,16-18,23,25-27,38H,6,10,12-15,33H2,(H,36,39)(H,40,43)(H,41,44)(H,42,45)(H,46,47)(H4,34,35,37) |
| InChIKey | RHXXNLKJAGWOCN-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 259.49 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.74 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|