C29H43N11O5 — CID 18309071
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18309071) has the molecular formula C29H43N11O5 and a molecular weight of 625.74 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18309071 |
| Molecular Formula | C29H43N11O5 |
| Molecular Weight | 625.74 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C29H43N11O5/c30-10-4-3-7-20(31)25(41)39-23(12-17-14-36-21-8-2-1-6-19(17)21)27(43)38-22(9-5-11-35-29(32)33)26(42)40-24(28(44)45)13-18-15-34-16-37-18/h1-2,6,8,14-16,20,22-24,36H,3-5,7,9-13,30-31H2,(H,34,37)(H,38,43)(H,39,41)(H,40,42)(H,44,45)(H4,32,33,35) |
| InChIKey | FPQNPSYUMQHKLG-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 285.51 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.74 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|