C26H39N9O7 — CID 19940977
2-[[5-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 19940977) has the molecular formula C26H39N9O7 and a molecular weight of 589.65 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[5-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 19940977 |
| Molecular Formula | C26H39N9O7 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | 2-[[5-amino-2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C26H39N9O7/c1-13(36)21(28)24(40)35-19(11-14-12-32-16-6-3-2-5-15(14)16)23(39)33-17(8-9-20(27)37)22(38)34-18(25(41)42)7-4-10-31-26(29)30/h2-3,5-6,12-13,17-19,21,32,36H,4,7-11,28H2,1H3,(H2,27,37)(H,33,39)(H,34,38)(H,35,40)(H,41,42)(H4,29,30,31) |
| InChIKey | XOKGGAIYRKTYDB-UHFFFAOYSA-N |
| XLogP | -2.72 |
| TPSA | 294.13 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|