C25H37N9O7 — CID 19940878
4-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid (PubChem CID 19940878) has the molecular formula C25H37N9O7 and a molecular weight of 575.63 g/mol. Its IUPAC name is 4-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 19940878 |
| Molecular Formula | C25H37N9O7 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | 4-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C25H37N9O7/c1-12(35)20(27)23(39)33-17(9-13-11-31-15-6-3-2-5-14(13)15)22(38)32-16(7-4-8-30-25(28)29)21(37)34-18(24(40)41)10-19(26)36/h2-3,5-6,11-12,16-18,20,31,35H,4,7-10,27H2,1H3,(H2,26,36)(H,32,38)(H,33,39)(H,34,37)(H,40,41)(H4,28,29,30) |
| InChIKey | RPUKLRBPSLNCPH-UHFFFAOYSA-N |
| XLogP | -3.11 |
| TPSA | 294.13 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|