C25H37N9O7 — CID 175969870
(2S)-2-[[2-[[(2S)-2-[[2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 175969870) has the molecular formula C25H37N9O7 and a molecular weight of 575.63 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2S)-2-[[2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[2-[[(2S)-2-[[2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 175969870 |
| Molecular Formula | C25H37N9O7 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | (2S)-2-[[2-[[(2S)-2-[[2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | C[C@@H](O)[C@H](N)C(=O)NCC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C25H37N9O7/c1-13(35)21(26)23(39)32-12-20(37)34-18(9-14-10-30-16-6-3-2-5-15(14)16)22(38)31-11-19(36)33-17(24(40)41)7-4-8-29-25(27)28/h2-3,5-6,10,13,17-18,21,30,35H,4,7-9,11-12,26H2,1H3,(H,31,38)(H,32,39)(H,33,36)(H,34,37)(H,40,41)(H4,27,28,29)/t13-,17+,18+,21+/m1/s1 |
| InChIKey | IJFCLECMUDQILG-ILLDPMRGSA-N |
| XLogP | -3.24 |
| TPSA | 280.14 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|