C22H32N8O5S — CID 18257616
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18257616) has the molecular formula C22H32N8O5S and a molecular weight of 520.62 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18257616 |
| Molecular Formula | C22H32N8O5S |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C22H32N8O5S/c23-14(11-36)19(32)28-10-18(31)29-17(8-12-9-27-15-5-2-1-4-13(12)15)20(33)30-16(21(34)35)6-3-7-26-22(24)25/h1-2,4-5,9,14,16-17,27,36H,3,6-8,10-11,23H2,(H,28,32)(H,29,31)(H,30,33)(H,34,35)(H4,24,25,26) |
| InChIKey | SUNUNRSTWUSFFA-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 230.81 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|