C25H34N10O5 — CID 18495766
2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18495766) has the molecular formula C25H34N10O5 and a molecular weight of 554.61 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18495766 |
| Molecular Formula | C25H34N10O5 |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)C(N)Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C25H34N10O5/c26-17(9-15-11-29-13-33-15)22(37)32-12-21(36)34-20(8-14-10-31-18-5-2-1-4-16(14)18)23(38)35-19(24(39)40)6-3-7-30-25(27)28/h1-2,4-5,10-11,13,17,19-20,31H,3,6-9,12,26H2,(H,29,33)(H,32,37)(H,34,36)(H,35,38)(H,39,40)(H4,27,28,30) |
| InChIKey | NTTHYBHYZQLCEW-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 259.49 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|