C26H36N10O6 — CID 19942624
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 19942624) has the molecular formula C26H36N10O6 and a molecular weight of 584.64 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 19942624 |
| Molecular Formula | C26H36N10O6 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C26H36N10O6/c27-17(8-14-10-32-18-5-2-1-4-16(14)18)22(38)34-19(6-3-7-31-26(28)29)23(39)35-20(9-15-11-30-13-33-15)24(40)36-21(12-37)25(41)42/h1-2,4-5,10-11,13,17,19-21,32,37H,3,6-9,12,27H2,(H,30,33)(H,34,38)(H,35,39)(H,36,40)(H,41,42)(H4,28,29,31) |
| InChIKey | MUPVMZKBIKHWFO-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 279.72 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|