C24H32N6O9 — CID 18746639
5-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-carboxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoic acid (PubChem CID 18746639) has the molecular formula C24H32N6O9 and a molecular weight of 548.55 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-carboxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-carboxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18746639 |
| Molecular Formula | C24H32N6O9 |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 5-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-carboxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C24H32N6O9/c1-11(31)20(26)23(37)30-17(9-19(33)34)22(36)29-16(8-12-10-27-14-5-3-2-4-13(12)14)21(35)28-15(24(38)39)6-7-18(25)32/h2-5,10-11,15-17,20,27,31H,6-9,26H2,1H3,(H2,25,32)(H,28,35)(H,29,36)(H,30,37)(H,33,34)(H,38,39) |
| InChIKey | KCEPWVMGWZXWEJ-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 267.03 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |