C24H33N7O8 — CID 18747549
2-[[4-amino-2-[[5-amino-2-[(2-amino-3-hydroxybutanoyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18747549) has the molecular formula C24H33N7O8 and a molecular weight of 547.57 g/mol. Its IUPAC name is 2-[[4-amino-2-[[5-amino-2-[(2-amino-3-hydroxybutanoyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[4-amino-2-[[5-amino-2-[(2-amino-3-hydroxybutanoyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18747549 |
| Molecular Formula | C24H33N7O8 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 2-[[4-amino-2-[[5-amino-2-[(2-amino-3-hydroxybutanoyl)amino]-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C24H33N7O8/c1-11(32)20(27)23(37)29-15(6-7-18(25)33)21(35)30-16(9-19(26)34)22(36)31-17(24(38)39)8-12-10-28-14-5-3-2-4-13(12)14/h2-5,10-11,15-17,20,28,32H,6-9,27H2,1H3,(H2,25,33)(H2,26,34)(H,29,37)(H,30,35)(H,31,36)(H,38,39) |
| InChIKey | JEDYSFPBSGZBQH-UHFFFAOYSA-N |
| XLogP | -2.90 |
| TPSA | 272.82 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |