C23H30N6O8 — CID 18239451
2-[[5-amino-2-[[2-(2-aminopropanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid (PubChem CID 18239451) has the molecular formula C23H30N6O8 and a molecular weight of 518.53 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-(2-aminopropanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[5-amino-2-[[2-(2-aminopropanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18239451 |
| Molecular Formula | C23H30N6O8 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 2-[[5-amino-2-[[2-(2-aminopropanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-5-oxopentanoyl]amino]butanedioic acid |
| SMILES | CC(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCC(N)=O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H30N6O8/c1-11(24)20(33)28-16(8-12-10-26-14-5-3-2-4-13(12)14)22(35)27-15(6-7-18(25)30)21(34)29-17(23(36)37)9-19(31)32/h2-5,10-11,15-17,26H,6-9,24H2,1H3,(H2,25,30)(H,27,35)(H,28,33)(H,29,34)(H,31,32)(H,36,37) |
| InChIKey | HMFLGBQYLQPLBE-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 246.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |