C22H27N5O9 — CID 18234117
2-[[2-[[2-(2-aminopropanoylamino)-3-carboxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid (PubChem CID 18234117) has the molecular formula C22H27N5O9 and a molecular weight of 505.48 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-3-carboxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-carboxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18234117 |
| Molecular Formula | C22H27N5O9 |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-carboxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
| SMILES | CC(N)C(=O)NC(CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H27N5O9/c1-10(23)19(32)25-15(7-17(28)29)21(34)26-14(20(33)27-16(22(35)36)8-18(30)31)6-11-9-24-13-5-3-2-4-12(11)13/h2-5,9-10,14-16,24H,6-8,23H2,1H3,(H,25,32)(H,26,34)(H,27,33)(H,28,29)(H,30,31)(H,35,36) |
| InChIKey | HLKHRUJNFXPDKB-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 241.01 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |