C17H22N4O5 — CID 18218555
2-[[2-(2-aminopropanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18218555) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[[2-(2-aminopropanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-(2-aminopropanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18218555 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[[2-(2-aminopropanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C17H22N4O5/c1-9(18)15(23)20-13(16(24)21-14(8-22)17(25)26)6-10-7-19-12-5-3-2-4-11(10)12/h2-5,7,9,13-14,19,22H,6,8,18H2,1H3,(H,20,23)(H,21,24)(H,25,26) |
| InChIKey | TVUFMYKTYXTRPY-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 157.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |