C25H36N10O6 — CID 22652649
2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid (PubChem CID 22652649) has the molecular formula C25H36N10O6 and a molecular weight of 572.63 g/mol. Its IUPAC name is 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22652649 |
| Molecular Formula | C25H36N10O6 |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NC(=O)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H36N10O6/c26-16(11-20(27)36)21(37)33-17(7-4-8-31-25(28)29)22(38)34-18(10-15-12-30-13-32-15)23(39)35-19(24(40)41)9-14-5-2-1-3-6-14/h1-3,5-6,12-13,16-19H,4,7-11,26H2,(H2,27,36)(H,30,32)(H,33,37)(H,34,38)(H,35,39)(H,40,41)(H4,28,29,31) |
| InChIKey | VGTVQNRGOCXLSO-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 286.79 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|