C22H39N11O6 — CID 22655491
2-[[6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 22655491) has the molecular formula C22H39N11O6 and a molecular weight of 553.63 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 22655491 |
| Molecular Formula | C22H39N11O6 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C22H39N11O6/c23-6-2-1-4-14(19(36)32-15(21(38)39)5-3-7-29-22(26)27)31-20(37)16(8-12-10-28-11-30-12)33-18(35)13(24)9-17(25)34/h10-11,13-16H,1-9,23-24H2,(H2,25,34)(H,28,30)(H,31,37)(H,32,36)(H,33,35)(H,38,39)(H4,26,27,29) |
| InChIKey | MYUJMAIDPDDUGC-UHFFFAOYSA-N |
| XLogP | -4.12 |
| TPSA | 312.81 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|