C19H32N10O7 — CID 22658222
5-(diaminomethylideneamino)-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanoic acid (PubChem CID 22658222) has the molecular formula C19H32N10O7 and a molecular weight of 512.53 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 22658222 |
| Molecular Formula | C19H32N10O7 |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]pentanoic acid |
| SMILES | NC(=O)CC(N)C(=O)NC(CO)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H32N10O7/c20-10(5-14(21)31)15(32)29-13(7-30)17(34)28-12(4-9-6-24-8-26-9)16(33)27-11(18(35)36)2-1-3-25-19(22)23/h6,8,10-13,30H,1-5,7,20H2,(H2,21,31)(H,24,26)(H,27,33)(H,28,34)(H,29,32)(H,35,36)(H4,22,23,25) |
| InChIKey | GWDVMQKRMWPNDW-UHFFFAOYSA-N |
| XLogP | -5.26 |
| TPSA | 307.02 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | -5.26 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|