C18H26N6O3 — CID 21112009
methyl 2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate (PubChem CID 21112009) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is methyl 2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate.
| Compound Name | methyl 2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 21112009 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | methyl 2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate |
| SMILES | COC(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H26N6O3/c1-27-17(26)15(7-4-8-22-18(20)21)24-16(25)13(19)9-11-10-23-14-6-3-2-5-12(11)14/h2-3,5-6,10,13,15,23H,4,7-9,19H2,1H3,(H,24,25)(H4,20,21,22) |
| InChIKey | BKNVDNHXOVNRNE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 161.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|