C19H27N7O4 — CID 18224579
2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid (PubChem CID 18224579) has the molecular formula C19H27N7O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18224579 |
| Molecular Formula | C19H27N7O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NCC(=O)O |
| InChI | InChI=1S/C19H27N7O4/c20-13(8-11-9-24-14-5-2-1-4-12(11)14)17(29)26-15(6-3-7-23-19(21)22)18(30)25-10-16(27)28/h1-2,4-5,9,13,15,24H,3,6-8,10,20H2,(H,25,30)(H,26,29)(H,27,28)(H4,21,22,23) |
| InChIKey | SCQBNMKLZVCXNX-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 201.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|