C25H38N8O5 — CID 19942598
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-methylpentanoic acid (PubChem CID 19942598) has the molecular formula C25H38N8O5 and a molecular weight of 530.63 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 19942598 |
| Molecular Formula | C25H38N8O5 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)CNC(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H38N8O5/c1-3-14(2)21(24(37)38)33-20(34)13-31-23(36)19(9-6-10-29-25(27)28)32-22(35)17(26)11-15-12-30-18-8-5-4-7-16(15)18/h4-5,7-8,12,14,17,19,21,30H,3,6,9-11,13,26H2,1-2H3,(H,31,36)(H,32,35)(H,33,34)(H,37,38)(H4,27,28,29) |
| InChIKey | WPPKYUYEOVNRMJ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 230.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|