C24H41HgN8O3 — CID 142305034
(2S)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-N-(2-amino-2-oxoethyl)-5-(diaminomethylideneamino)pentanamide;methylmercury;2-methylpropane (PubChem CID 142305034) has the molecular formula C24H41HgN8O3 and a molecular weight of 690.24 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-N-(2-amino-2-oxoethyl)-5-(diaminomethylideneamino)pentanamide;methylmercury;2-methylpropane.
| Compound Name | (2S)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-N-(2-amino-2-oxoethyl)-5-(diaminomethylideneamino)pentanamide;methylmercury;2-methylpropane |
|---|---|
| PubChem CID | 142305034 |
| Molecular Formula | C24H41HgN8O3 |
| Molecular Weight | 690.24 g/mol |
| Exact Mass | 691.30 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-N-(2-amino-2-oxoethyl)-5-(diaminomethylideneamino)pentanamide;methylmercury;2-methylpropane |
| SMILES | CC(C)C.C[Hg].NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H28N8O3.C4H10.CH3.Hg/c20-13(8-11-9-25-14-5-2-1-4-12(11)14)17(29)27-15(6-3-7-24-19(22)23)18(30)26-10-16(21)28;1-4(2)3;;/h1-2,4-5,9,13,15,25H,3,6-8,10,20H2,(H2,21,28)(H,26,30)(H,27,29)(H4,22,23,24);4H,1-3H3;1H3;/t13-,15+;;;/m1.../s1 |
| InChIKey | HAUAABVBMFSKKK-MKPITOIQSA-N |
| XLogP | 0.42 |
| TPSA | 207.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|