C29H46N8O5 — CID 18298225
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid (PubChem CID 18298225) has the molecular formula C29H46N8O5 and a molecular weight of 586.74 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18298225 |
| Molecular Formula | C29H46N8O5 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.36 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCN=C(N)N)C(=O)NC(C(=O)O)C(C)CC |
| InChI | InChI=1S/C29H46N8O5/c1-5-16(3)23(30)27(40)36-22(14-18-15-34-20-11-8-7-10-19(18)20)26(39)35-21(12-9-13-33-29(31)32)25(38)37-24(28(41)42)17(4)6-2/h7-8,10-11,15-17,21-24,34H,5-6,9,12-14,30H2,1-4H3,(H,35,39)(H,36,40)(H,37,38)(H,41,42)(H4,31,32,33) |
| InChIKey | YIPPGHLDVJVMCV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 230.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|