C28H44N8O5 — CID 22702096
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 22702096) has the molecular formula C28H44N8O5 and a molecular weight of 572.71 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 22702096 |
| Molecular Formula | C28H44N8O5 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O)C(C)C |
| InChI | InChI=1S/C28H44N8O5/c1-5-16(4)22(29)25(38)36-23(15(2)3)26(39)34-20(11-8-12-32-28(30)31)24(37)35-21(27(40)41)13-17-14-33-19-10-7-6-9-18(17)19/h6-7,9-10,14-16,20-23,33H,5,8,11-13,29H2,1-4H3,(H,34,39)(H,35,37)(H,36,38)(H,40,41)(H4,30,31,32) |
| InChIKey | WKGWWUAKZMADFO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 230.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|