C20H28N6O4 — CID 58003116
methyl 5-(diaminomethylideneamino)-2-[[3-(1H-indol-3-yl)-2-[(2,2,2-trideuterioacetyl)amino]propanoyl]amino]pentanoate (PubChem CID 58003116) has the molecular formula C20H28N6O4 and a molecular weight of 419.50 g/mol. Its IUPAC name is methyl 5-(diaminomethylideneamino)-2-[[3-(1H-indol-3-yl)-2-[(2,2,2-trideuterioacetyl)amino]propanoyl]amino]pentanoate.
| Compound Name | methyl 5-(diaminomethylideneamino)-2-[[3-(1H-indol-3-yl)-2-[(2,2,2-trideuterioacetyl)amino]propanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 58003116 |
| Molecular Formula | C20H28N6O4 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | methyl 5-(diaminomethylideneamino)-2-[[3-(1H-indol-3-yl)-2-[(2,2,2-trideuterioacetyl)amino]propanoyl]amino]pentanoate |
| SMILES | [2H]C([2H])([2H])C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CCCN=C(N)N)C(=O)OC |
| InChI | InChI=1S/C20H28N6O4/c1-12(27)25-17(10-13-11-24-15-7-4-3-6-14(13)15)18(28)26-16(19(29)30-2)8-5-9-23-20(21)22/h3-4,6-7,11,16-17,24H,5,8-10H2,1-2H3,(H,25,27)(H,26,28)(H4,21,22,23)/i1D3 |
| InChIKey | PIUBECDFKOBNTR-FIBGUPNXSA-N |
| XLogP | -0.07 |
| TPSA | 164.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|