C30H39Cl2N9O4 — CID 164618714
methyl (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(2-phenyl-1H-imidazol-5-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate;dihydrochloride (PubChem CID 164618714) has the molecular formula C30H39Cl2N9O4 and a molecular weight of 660.61 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(2-phenyl-1H-imidazol-5-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate;dihydrochloride.
| Compound Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(2-phenyl-1H-imidazol-5-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
|---|---|
| PubChem CID | 164618714 |
| Molecular Formula | C30H39Cl2N9O4 |
| Molecular Weight | 660.61 g/mol |
| Exact Mass | 659.25 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(2-phenyl-1H-imidazol-5-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
| SMILES | COC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)Cc1cnc(-c2ccccc2)[nH]1.Cl.Cl |
| InChI | InChI=1S/C30H37N9O4.2ClH/c1-43-29(42)24(12-7-13-34-30(32)33)38-28(41)25(14-19-16-35-23-11-6-5-10-21(19)23)39-27(40)22(31)15-20-17-36-26(37-20)18-8-3-2-4-9-18;;/h2-6,8-11,16-17,22,24-25,35H,7,12-15,31H2,1H3,(H,36,37)(H,38,41)(H,39,40)(H4,32,33,34);2*1H/t22-,24-,25-;;/m0../s1 |
| InChIKey | HAYSEPRHEZPFOS-JELFJDDXSA-N |
| XLogP | 1.71 |
| TPSA | 219.39 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.61 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|