C19H33N7O3 — CID 44596659
methyl (2S)-2-[[(2S)-2-amino-3-(2-cyclohexyl-1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate (PubChem CID 44596659) has the molecular formula C19H33N7O3 and a molecular weight of 407.52 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-amino-3-(2-cyclohexyl-1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-amino-3-(2-cyclohexyl-1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 44596659 |
| Molecular Formula | C19H33N7O3 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-amino-3-(2-cyclohexyl-1H-imidazol-5-yl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoate |
| SMILES | COC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1cnc(C2CCCCC2)[nH]1 |
| InChI | InChI=1S/C19H33N7O3/c1-29-18(28)15(8-5-9-23-19(21)22)26-17(27)14(20)10-13-11-24-16(25-13)12-6-3-2-4-7-12/h11-12,14-15H,2-10,20H2,1H3,(H,24,25)(H,26,27)(H4,21,22,23)/t14-,15-/m0/s1 |
| InChIKey | JGPKWAMRADVTEI-GJZGRUSLSA-N |
| XLogP | 0.04 |
| TPSA | 174.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|