C28H44N8O4 — CID 44597945
tert-butyl N-[(2S)-1-[[(2S)-1-(benzylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(2-tert-butyl-1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 44597945) has the molecular formula C28H44N8O4 and a molecular weight of 556.71 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2S)-1-(benzylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(2-tert-butyl-1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2S)-1-(benzylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(2-tert-butyl-1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 44597945 |
| Molecular Formula | C28H44N8O4 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.35 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2S)-1-(benzylamino)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(2-tert-butyl-1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cnc(C(C)(C)C)[nH]1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H44N8O4/c1-27(2,3)24-33-17-19(34-24)15-21(36-26(39)40-28(4,5)6)23(38)35-20(13-10-14-31-25(29)30)22(37)32-16-18-11-8-7-9-12-18/h7-9,11-12,17,20-21H,10,13-16H2,1-6H3,(H,32,37)(H,33,34)(H,35,38)(H,36,39)(H4,29,30,31)/t20-,21-/m0/s1 |
| InChIKey | NBCRXWCBEFPJAR-SFTDATJTSA-N |
| XLogP | 2.00 |
| TPSA | 189.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|