C30H40N6O9 — CID 10394216
benzyl (4S)-5-[[(2S)-5-[[amino(nitramido)methylidene]amino]-1-oxo-1-phenylmethoxypentan-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate (PubChem CID 10394216) has the molecular formula C30H40N6O9 and a molecular weight of 628.68 g/mol. Its IUPAC name is benzyl (4S)-5-[[(2S)-5-[[amino(nitramido)methylidene]amino]-1-oxo-1-phenylmethoxypentan-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate.
| Compound Name | benzyl (4S)-5-[[(2S)-5-[[amino(nitramido)methylidene]amino]-1-oxo-1-phenylmethoxypentan-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 10394216 |
| Molecular Formula | C30H40N6O9 |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | benzyl (4S)-5-[[(2S)-5-[[amino(nitramido)methylidene]amino]-1-oxo-1-phenylmethoxypentan-2-yl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)OCc1ccccc1)C(=O)N[C@@H](CCC/N=C(\N)N[N+](=O)[O-])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H40N6O9/c1-30(2,3)45-29(40)34-23(16-17-25(37)43-19-21-11-6-4-7-12-21)26(38)33-24(15-10-18-32-28(31)35-36(41)42)27(39)44-20-22-13-8-5-9-14-22/h4-9,11-14,23-24H,10,15-20H2,1-3H3,(H,33,38)(H,34,40)(H3,31,32,35)/t23-,24-/m0/s1 |
| InChIKey | AIZAKODJKFQIHE-ZEQRLZLVSA-N |
| XLogP | 2.51 |
| TPSA | 213.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|