C11H23N5O5 — CID 13245618
tert-butyl N-[5-[[amino(nitramido)methylidene]amino]-1-hydroxypentan-2-yl]carbamate (PubChem CID 13245618) has the molecular formula C11H23N5O5 and a molecular weight of 305.34 g/mol. Its IUPAC name is tert-butyl N-[5-[[amino(nitramido)methylidene]amino]-1-hydroxypentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-[[amino(nitramido)methylidene]amino]-1-hydroxypentan-2-yl]carbamate |
|---|---|
| PubChem CID | 13245618 |
| Molecular Formula | C11H23N5O5 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | tert-butyl N-[5-[[amino(nitramido)methylidene]amino]-1-hydroxypentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CO)CCC/N=C(\N)N[N+](=O)[O-] |
| InChI | InChI=1S/C11H23N5O5/c1-11(2,3)21-10(18)14-8(7-17)5-4-6-13-9(12)15-16(19)20/h8,17H,4-7H2,1-3H3,(H,14,18)(H3,12,13,15) |
| InChIKey | WMJVFXGVPFUNJZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|