C13H27NO4 — CID 176970669
tert-butyl N-(1,5-dihydroxypentan-2-yl)carbamate;cyclopropane (PubChem CID 176970669) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is tert-butyl N-(1,5-dihydroxypentan-2-yl)carbamate;cyclopropane.
| Compound Name | tert-butyl N-(1,5-dihydroxypentan-2-yl)carbamate;cyclopropane |
|---|---|
| PubChem CID | 176970669 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | tert-butyl N-(1,5-dihydroxypentan-2-yl)carbamate;cyclopropane |
| SMILES | C1CC1.CC(C)(C)OC(=O)NC(CO)CCCO |
| InChI | InChI=1S/C10H21NO4.C3H6/c1-10(2,3)15-9(14)11-8(7-13)5-4-6-12;1-2-3-1/h8,12-13H,4-7H2,1-3H3,(H,11,14);1-3H2 |
| InChIKey | PBVYNZGAMWXEAJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |