C10H18F3NO3 — CID 86710332
tert-butyl N-(5,5,5-trifluoro-1-hydroxypentan-2-yl)carbamate (PubChem CID 86710332) has the molecular formula C10H18F3NO3 and a molecular weight of 257.25 g/mol. Its IUPAC name is tert-butyl N-(5,5,5-trifluoro-1-hydroxypentan-2-yl)carbamate.
| Compound Name | tert-butyl N-(5,5,5-trifluoro-1-hydroxypentan-2-yl)carbamate |
|---|---|
| PubChem CID | 86710332 |
| Molecular Formula | C10H18F3NO3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | tert-butyl N-(5,5,5-trifluoro-1-hydroxypentan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CO)CCC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO3/c1-9(2,3)17-8(16)14-7(6-15)4-5-10(11,12)13/h7,15H,4-6H2,1-3H3,(H,14,16) |
| InChIKey | BBVWKZYPGJJDEK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |