C9H18FNO3 — CID 93002503
tert-butyl N-[(2S)-1-fluoro-4-hydroxybutan-2-yl]carbamate (PubChem CID 93002503) has the molecular formula C9H18FNO3 and a molecular weight of 207.24 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-fluoro-4-hydroxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-fluoro-4-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 93002503 |
| Molecular Formula | C9H18FNO3 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | tert-butyl N-[(2S)-1-fluoro-4-hydroxybutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CF)CCO |
| InChI | InChI=1S/C9H18FNO3/c1-9(2,3)14-8(13)11-7(6-10)4-5-12/h7,12H,4-6H2,1-3H3,(H,11,13)/t7-/m0/s1 |
| InChIKey | BSUYMAYNARYLKC-ZETCQYMHSA-N |
| XLogP | 1.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |