C10H21NO4 — CID 53259998
tert-butyl N-[(2S)-4-hydroxy-1-methoxybutan-2-yl]carbamate (PubChem CID 53259998) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-hydroxy-1-methoxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-hydroxy-1-methoxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 53259998 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | tert-butyl N-[(2S)-4-hydroxy-1-methoxybutan-2-yl]carbamate |
| SMILES | COC[C@H](CCO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H21NO4/c1-10(2,3)15-9(13)11-8(5-6-12)7-14-4/h8,12H,5-7H2,1-4H3,(H,11,13)/t8-/m0/s1 |
| InChIKey | VFICVOGJYRPEIU-QMMMGPOBSA-N |
| XLogP | 0.91 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |