C10H21NO3 — CID 46941495
tert-butyl N-[(2S)-1-methoxybutan-2-yl]carbamate (PubChem CID 46941495) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-methoxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-methoxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 46941495 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | tert-butyl N-[(2S)-1-methoxybutan-2-yl]carbamate |
| SMILES | CC[C@@H](COC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H21NO3/c1-6-8(7-13-5)11-9(12)14-10(2,3)4/h8H,6-7H2,1-5H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | DZQBOXFQDSCNRZ-QMMMGPOBSA-N |
| XLogP | 1.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |