C13H28N2O3 — CID 152912465
tert-butyl N-[(2S)-1-methoxy-6-(methylamino)hexan-2-yl]carbamate (PubChem CID 152912465) has the molecular formula C13H28N2O3 and a molecular weight of 260.38 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-methoxy-6-(methylamino)hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-methoxy-6-(methylamino)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 152912465 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | tert-butyl N-[(2S)-1-methoxy-6-(methylamino)hexan-2-yl]carbamate |
| SMILES | CNCCCC[C@@H](COC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H28N2O3/c1-13(2,3)18-12(16)15-11(10-17-5)8-6-7-9-14-4/h11,14H,6-10H2,1-5H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | UHLXUNADYUFHET-NSHDSACASA-N |
| XLogP | 1.92 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|