C14H31N3O3 — CID 145013011
tert-butyl N-[1-amino-6-(methylamino)-1-oxohexan-2-yl]carbamate;ethane (PubChem CID 145013011) has the molecular formula C14H31N3O3 and a molecular weight of 289.42 g/mol. Its IUPAC name is tert-butyl N-[1-amino-6-(methylamino)-1-oxohexan-2-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[1-amino-6-(methylamino)-1-oxohexan-2-yl]carbamate;ethane |
|---|---|
| PubChem CID | 145013011 |
| Molecular Formula | C14H31N3O3 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | tert-butyl N-[1-amino-6-(methylamino)-1-oxohexan-2-yl]carbamate;ethane |
| SMILES | CC.CNCCCCC(NC(=O)OC(C)(C)C)C(N)=O |
| InChI | InChI=1S/C12H25N3O3.C2H6/c1-12(2,3)18-11(17)15-9(10(13)16)7-5-6-8-14-4;1-2/h9,14H,5-8H2,1-4H3,(H2,13,16)(H,15,17);1-2H3 |
| InChIKey | UYSMOKILQKFZTI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|