C15H29N3O5 — CID 175110455
methyl 6-(2-aminopropanoylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 175110455) has the molecular formula C15H29N3O5 and a molecular weight of 331.41 g/mol. Its IUPAC name is methyl 6-(2-aminopropanoylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | methyl 6-(2-aminopropanoylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 175110455 |
| Molecular Formula | C15H29N3O5 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | methyl 6-(2-aminopropanoylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | COC(=O)C(CCCCNC(=O)C(C)N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29N3O5/c1-10(16)12(19)17-9-7-6-8-11(13(20)22-5)18-14(21)23-15(2,3)4/h10-11H,6-9,16H2,1-5H3,(H,17,19)(H,18,21) |
| InChIKey | ABORTYVXSWYUHM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|