C11H20N2O6 — CID 11219607
methyl (2S)-2,6-bis(methoxycarbonylamino)hexanoate (PubChem CID 11219607) has the molecular formula C11H20N2O6 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl (2S)-2,6-bis(methoxycarbonylamino)hexanoate.
| Compound Name | methyl (2S)-2,6-bis(methoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 11219607 |
| Molecular Formula | C11H20N2O6 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | methyl (2S)-2,6-bis(methoxycarbonylamino)hexanoate |
| SMILES | COC(=O)NCCCC[C@H](NC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C11H20N2O6/c1-17-9(14)8(13-11(16)19-3)6-4-5-7-12-10(15)18-2/h8H,4-7H2,1-3H3,(H,12,15)(H,13,16)/t8-/m0/s1 |
| InChIKey | KKPDAYYVJRGBGF-QMMMGPOBSA-N |
| XLogP | 0.41 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|