C15H29N3O6 — CID 89290011
methyl N-[1-(4-methoxybutylamino)-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 89290011) has the molecular formula C15H29N3O6 and a molecular weight of 347.41 g/mol. Its IUPAC name is methyl N-[1-(4-methoxybutylamino)-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | methyl N-[1-(4-methoxybutylamino)-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 89290011 |
| Molecular Formula | C15H29N3O6 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | methyl N-[1-(4-methoxybutylamino)-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | COCCCCNC(=O)C(CCCCNC(=O)OC)NC(=O)OC |
| InChI | InChI=1S/C15H29N3O6/c1-22-11-7-6-9-16-13(19)12(18-15(21)24-3)8-4-5-10-17-14(20)23-2/h12H,4-11H2,1-3H3,(H,16,19)(H,17,20)(H,18,21) |
| InChIKey | WLRVAXYXMKFMJM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|