C24H49N3O13P- — CID 159356747
4-[2,6-bis[2-(2-methoxyethoxy)ethoxycarbonylamino]hexanoylamino]butyl methyl phosphate;methane (PubChem CID 159356747) has the molecular formula C24H49N3O13P- and a molecular weight of 618.64 g/mol. Its IUPAC name is 4-[2,6-bis[2-(2-methoxyethoxy)ethoxycarbonylamino]hexanoylamino]butyl methyl phosphate;methane.
| Compound Name | 4-[2,6-bis[2-(2-methoxyethoxy)ethoxycarbonylamino]hexanoylamino]butyl methyl phosphate;methane |
|---|---|
| PubChem CID | 159356747 |
| Molecular Formula | C24H49N3O13P- |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | 4-[2,6-bis[2-(2-methoxyethoxy)ethoxycarbonylamino]hexanoylamino]butyl methyl phosphate;methane |
| SMILES | C.COCCOCCOC(=O)NCCCCC(NC(=O)OCCOCCOC)C(=O)NCCCCOP(=O)([O-])OC |
| InChI | InChI=1S/C23H46N3O13P.CH4/c1-32-12-14-35-16-18-37-22(28)25-10-5-4-8-20(26-23(29)38-19-17-36-15-13-33-2)21(27)24-9-6-7-11-39-40(30,31)34-3;/h20H,4-19H2,1-3H3,(H,24,27)(H,25,28)(H,26,29)(H,30,31);1H4/p-1 |
| InChIKey | LIACXZOKZZQLGO-UHFFFAOYSA-M |
| XLogP | 0.97 |
| TPSA | 201.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|