C24H45N3O11 — CID 165074029
tert-butyl N-[9-[2-(2-methoxyethoxy)ethoxycarbonylamino]-5-(1-methylperoxyethoxycarbonylamino)-4-oxononyl]carbamate (PubChem CID 165074029) has the molecular formula C24H45N3O11 and a molecular weight of 551.63 g/mol. Its IUPAC name is tert-butyl N-[9-[2-(2-methoxyethoxy)ethoxycarbonylamino]-5-(1-methylperoxyethoxycarbonylamino)-4-oxononyl]carbamate.
| Compound Name | tert-butyl N-[9-[2-(2-methoxyethoxy)ethoxycarbonylamino]-5-(1-methylperoxyethoxycarbonylamino)-4-oxononyl]carbamate |
|---|---|
| PubChem CID | 165074029 |
| Molecular Formula | C24H45N3O11 |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | tert-butyl N-[9-[2-(2-methoxyethoxy)ethoxycarbonylamino]-5-(1-methylperoxyethoxycarbonylamino)-4-oxononyl]carbamate |
| SMILES | COCCOCCOC(=O)NCCCCC(NC(=O)OC(C)OOC)C(=O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H45N3O11/c1-18(38-33-6)36-23(31)27-19(20(28)11-9-13-26-22(30)37-24(2,3)4)10-7-8-12-25-21(29)35-17-16-34-15-14-32-5/h18-19H,7-17H2,1-6H3,(H,25,29)(H,26,30)(H,27,31) |
| InChIKey | MNZXPIWZQYTVCC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 168.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|