C23H43NO10 — CID 11569485
3-O-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl] 1-O-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl] propanedioate (PubChem CID 11569485) has the molecular formula C23H43NO10 and a molecular weight of 493.59 g/mol. Its IUPAC name is 3-O-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl] 1-O-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl] propanedioate.
| Compound Name | 3-O-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl] 1-O-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl] propanedioate |
|---|---|
| PubChem CID | 11569485 |
| Molecular Formula | C23H43NO10 |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | 3-O-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl] 1-O-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl] propanedioate |
| SMILES | COCCOCCOCCOCCOC(=O)CC(=O)OCCCCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H43NO10/c1-23(2,3)34-22(27)24-9-7-5-6-8-10-32-20(25)19-21(26)33-18-17-31-16-15-30-14-13-29-12-11-28-4/h5-19H2,1-4H3,(H,24,27) |
| InChIKey | NEBQFLTUQNMOPD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|