About 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate
3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate (PubChem CID 164778547) has the molecular formula C11H18N2O4
and a molecular weight of 242.27 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate.
Molecular Properties
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate |
| PubChem CID | 164778547 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate |
| SMILES | [C-]#[N+]CC(=O)OCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H18N2O4/c1-11(2,3)17-10(15)13-6-5-7-16-9(14)8-12-4/h5-8H2,1-3H3,(H,13,15) |
| InChIKey | IOPLKTUSWQVFNV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate?
The IUPAC name of 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate (CID 164778547) is 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate.
What is the SMILES notation for 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate?
The canonical SMILES for 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate is [C-]#[N+]CC(=O)OCCCNC(=O)OC(C)(C)C.
What is the InChIKey of 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate?
The InChIKey is IOPLKTUSWQVFNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O4/c1-11(2,3)17-10(15)13-6-5-7-16-9(14)8-12-4/h5-8H2,1-3H3,(H,13,15).
What are the key properties of 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate?
3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate has a molecular weight of 242.27 g/mol, XLogP of 1.36, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl 2-isocyanoacetate is sourced from PubChem (CID 164778547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).