C9H20N4O2 — CID 15311263
tert-butyl N-[3-(diaminomethylideneamino)propyl]carbamate (PubChem CID 15311263) has the molecular formula C9H20N4O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is tert-butyl N-[3-(diaminomethylideneamino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(diaminomethylideneamino)propyl]carbamate |
|---|---|
| PubChem CID | 15311263 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | tert-butyl N-[3-(diaminomethylideneamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN=C(N)N |
| InChI | InChI=1S/C9H20N4O2/c1-9(2,3)15-8(14)13-6-4-5-12-7(10)11/h4-6H2,1-3H3,(H,13,14)(H4,10,11,12) |
| InChIKey | QHIGQATVSUIJFN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|